C28H25N3O7 — CID 90450361
[4-carboxyoxy-1-[[4-[5-(4-phenylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidin-4-yl] hydrogen carbonate (PubChem CID 90450361) has the molecular formula C28H25N3O7 and a molecular weight of 515.52 g/mol. Its IUPAC name is [4-carboxyoxy-1-[[4-[5-(4-phenylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidin-4-yl] hydrogen carbonate.
| Compound Name | [4-carboxyoxy-1-[[4-[5-(4-phenylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidin-4-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 90450361 |
| Molecular Formula | C28H25N3O7 |
| Molecular Weight | 515.52 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | [4-carboxyoxy-1-[[4-[5-(4-phenylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidin-4-yl] hydrogen carbonate |
| SMILES | O=C(O)OC1(OC(=O)O)CCN(Cc2ccc(-c3noc(-c4ccc(-c5ccccc5)cc4)n3)cc2)CC1 |
| InChI | InChI=1S/C28H25N3O7/c32-26(33)36-28(37-27(34)35)14-16-31(17-15-28)18-19-6-8-22(9-7-19)24-29-25(38-30-24)23-12-10-21(11-13-23)20-4-2-1-3-5-20/h1-13H,14-18H2,(H,32,33)(H,34,35) |
| InChIKey | XKDCVLMNCGWINB-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.52 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|