C36H30FN3O8 — CID 90450307
[4-carboxyoxy-1-[[4-[5-(3-fluoro-4-phenylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidin-4-yl] phenacyl carbonate (PubChem CID 90450307) has the molecular formula C36H30FN3O8 and a molecular weight of 651.65 g/mol. Its IUPAC name is [4-carboxyoxy-1-[[4-[5-(3-fluoro-4-phenylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidin-4-yl] phenacyl carbonate.
| Compound Name | [4-carboxyoxy-1-[[4-[5-(3-fluoro-4-phenylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidin-4-yl] phenacyl carbonate |
|---|---|
| PubChem CID | 90450307 |
| Molecular Formula | C36H30FN3O8 |
| Molecular Weight | 651.65 g/mol |
| Exact Mass | 651.20 |
| IUPAC Name | [4-carboxyoxy-1-[[4-[5-(3-fluoro-4-phenylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidin-4-yl] phenacyl carbonate |
| SMILES | O=C(O)OC1(OC(=O)OCC(=O)c2ccccc2)CCN(Cc2ccc(-c3noc(-c4ccc(-c5ccccc5)c(F)c4)n3)cc2)CC1 |
| InChI | InChI=1S/C36H30FN3O8/c37-30-21-28(15-16-29(30)25-7-3-1-4-8-25)33-38-32(39-48-33)27-13-11-24(12-14-27)22-40-19-17-36(18-20-40,46-34(42)43)47-35(44)45-23-31(41)26-9-5-2-6-10-26/h1-16,21H,17-20,22-23H2,(H,42,43) |
| InChIKey | CTPHQJRPPKOJKK-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.65 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|