C36H37FN4O8 — CID 90450080
cyclohexylcarbamoyl [1-[[4-[5-(3-fluoro-4-phenylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-4-methoxycarbonyloxypiperidin-4-yl] carbonate (PubChem CID 90450080) has the molecular formula C36H37FN4O8 and a molecular weight of 672.71 g/mol. Its IUPAC name is cyclohexylcarbamoyl [1-[[4-[5-(3-fluoro-4-phenylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-4-methoxycarbonyloxypiperidin-4-yl] carbonate.
| Compound Name | cyclohexylcarbamoyl [1-[[4-[5-(3-fluoro-4-phenylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-4-methoxycarbonyloxypiperidin-4-yl] carbonate |
|---|---|
| PubChem CID | 90450080 |
| Molecular Formula | C36H37FN4O8 |
| Molecular Weight | 672.71 g/mol |
| Exact Mass | 672.26 |
| IUPAC Name | cyclohexylcarbamoyl [1-[[4-[5-(3-fluoro-4-phenylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-4-methoxycarbonyloxypiperidin-4-yl] carbonate |
| SMILES | COC(=O)OC1(OC(=O)OC(=O)NC2CCCCC2)CCN(Cc2ccc(-c3noc(-c4ccc(-c5ccccc5)c(F)c4)n3)cc2)CC1 |
| InChI | InChI=1S/C36H37FN4O8/c1-45-34(43)47-36(48-35(44)46-33(42)38-28-10-6-3-7-11-28)18-20-41(21-19-36)23-24-12-14-26(15-13-24)31-39-32(49-40-31)27-16-17-29(30(37)22-27)25-8-4-2-5-9-25/h2,4-5,8-9,12-17,22,28H,3,6-7,10-11,18-21,23H2,1H3,(H,38,42) |
| InChIKey | BEXOQNUVWZZNRU-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 142.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.71 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|