C33H34FN3O7 — CID 90450416
[4-carboxyoxy-1-[[4-[5-(3-fluoro-4-phenylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidin-4-yl] pentyl carbonate (PubChem CID 90450416) has the molecular formula C33H34FN3O7 and a molecular weight of 603.65 g/mol. Its IUPAC name is [4-carboxyoxy-1-[[4-[5-(3-fluoro-4-phenylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidin-4-yl] pentyl carbonate.
| Compound Name | [4-carboxyoxy-1-[[4-[5-(3-fluoro-4-phenylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidin-4-yl] pentyl carbonate |
|---|---|
| PubChem CID | 90450416 |
| Molecular Formula | C33H34FN3O7 |
| Molecular Weight | 603.65 g/mol |
| Exact Mass | 603.24 |
| IUPAC Name | [4-carboxyoxy-1-[[4-[5-(3-fluoro-4-phenylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidin-4-yl] pentyl carbonate |
| SMILES | CCCCCOC(=O)OC1(OC(=O)O)CCN(Cc2ccc(-c3noc(-c4ccc(-c5ccccc5)c(F)c4)n3)cc2)CC1 |
| InChI | InChI=1S/C33H34FN3O7/c1-2-3-7-20-41-32(40)43-33(42-31(38)39)16-18-37(19-17-33)22-23-10-12-25(13-11-23)29-35-30(44-36-29)26-14-15-27(28(34)21-26)24-8-5-4-6-9-24/h4-6,8-15,21H,2-3,7,16-20,22H2,1H3,(H,38,39) |
| InChIKey | QKJKBVBYSFHOAO-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.65 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|