C35H35FN4O8 — CID 90450364
cyclopentylcarbamoyl [1-[[4-[5-(3-fluoro-4-phenylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-4-methoxycarbonyloxypiperidin-4-yl] carbonate (PubChem CID 90450364) has the molecular formula C35H35FN4O8 and a molecular weight of 658.68 g/mol. Its IUPAC name is cyclopentylcarbamoyl [1-[[4-[5-(3-fluoro-4-phenylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-4-methoxycarbonyloxypiperidin-4-yl] carbonate.
| Compound Name | cyclopentylcarbamoyl [1-[[4-[5-(3-fluoro-4-phenylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-4-methoxycarbonyloxypiperidin-4-yl] carbonate |
|---|---|
| PubChem CID | 90450364 |
| Molecular Formula | C35H35FN4O8 |
| Molecular Weight | 658.68 g/mol |
| Exact Mass | 658.24 |
| IUPAC Name | cyclopentylcarbamoyl [1-[[4-[5-(3-fluoro-4-phenylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-4-methoxycarbonyloxypiperidin-4-yl] carbonate |
| SMILES | COC(=O)OC1(OC(=O)OC(=O)NC2CCCC2)CCN(Cc2ccc(-c3noc(-c4ccc(-c5ccccc5)c(F)c4)n3)cc2)CC1 |
| InChI | InChI=1S/C35H35FN4O8/c1-44-33(42)46-35(47-34(43)45-32(41)37-27-9-5-6-10-27)17-19-40(20-18-35)22-23-11-13-25(14-12-23)30-38-31(48-39-30)26-15-16-28(29(36)21-26)24-7-3-2-4-8-24/h2-4,7-8,11-16,21,27H,5-6,9-10,17-20,22H2,1H3,(H,37,41) |
| InChIKey | JMNYMGXOFYZYJU-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 142.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.68 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|