C19H19FIN5O2S — CID 70915897
N-[3-[(4S)-2-amino-6-(1-hydroxy-1-iodoethyl)-4-methyl-1,3-thiazin-4-yl]-4-fluorophenyl]-5-methylpyrazine-2-carboxamide (PubChem CID 70915897) has the molecular formula C19H19FIN5O2S and a molecular weight of 527.36 g/mol. Its IUPAC name is N-[3-[(4S)-2-amino-6-(1-hydroxy-1-iodoethyl)-4-methyl-1,3-thiazin-4-yl]-4-fluorophenyl]-5-methylpyrazine-2-carboxamide.
| Compound Name | N-[3-[(4S)-2-amino-6-(1-hydroxy-1-iodoethyl)-4-methyl-1,3-thiazin-4-yl]-4-fluorophenyl]-5-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 70915897 |
| Molecular Formula | C19H19FIN5O2S |
| Molecular Weight | 527.36 g/mol |
| Exact Mass | 527.03 |
| IUPAC Name | N-[3-[(4S)-2-amino-6-(1-hydroxy-1-iodoethyl)-4-methyl-1,3-thiazin-4-yl]-4-fluorophenyl]-5-methylpyrazine-2-carboxamide |
| SMILES | Cc1cnc(C(=O)Nc2ccc(F)c([C@]3(C)C=C(C(C)(O)I)SC(N)=N3)c2)cn1 |
| InChI | InChI=1S/C19H19FIN5O2S/c1-10-8-24-14(9-23-10)16(27)25-11-4-5-13(20)12(6-11)18(2)7-15(19(3,21)28)29-17(22)26-18/h4-9,28H,1-3H3,(H2,22,26)(H,25,27)/t18-,19?/m0/s1 |
| InChIKey | ZOMNTYAUKMFXNC-OYKVQYDMSA-N |
| XLogP | 3.48 |
| TPSA | 113.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|