C16H18N2O4S3 — CID 70917177
(2R,6aR)-1-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid (PubChem CID 70917177) has the molecular formula C16H18N2O4S3 and a molecular weight of 398.53 g/mol. Its IUPAC name is (2R,6aR)-1-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid.
| Compound Name | (2R,6aR)-1-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 70917177 |
| Molecular Formula | C16H18N2O4S3 |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | (2R,6aR)-1-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid |
| SMILES | Cc1nc(-c2ccc(S(=O)(=O)N3[C@@H](C(=O)O)CC4CCC[C@H]43)s2)cs1 |
| InChI | InChI=1S/C16H18N2O4S3/c1-9-17-11(8-23-9)14-5-6-15(24-14)25(21,22)18-12-4-2-3-10(12)7-13(18)16(19)20/h5-6,8,10,12-13H,2-4,7H2,1H3,(H,19,20)/t10?,12-,13-/m1/s1 |
| InChIKey | PVOOAIVPGYLJCU-SKVSWLLESA-N |
| XLogP | 3.20 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |