C18H20N2O4S — CID 124696364
(2S,3aR,7aS)-1-[5-(2-methyl-1,3-thiazol-4-yl)furan-3-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 124696364) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is (2S,3aR,7aS)-1-[5-(2-methyl-1,3-thiazol-4-yl)furan-3-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | (2S,3aR,7aS)-1-[5-(2-methyl-1,3-thiazol-4-yl)furan-3-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 124696364 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (2S,3aR,7aS)-1-[5-(2-methyl-1,3-thiazol-4-yl)furan-3-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | Cc1nc(-c2cc(C(=O)N3[C@H](C(=O)O)C[C@H]4CCCC[C@@H]43)co2)cs1 |
| InChI | InChI=1S/C18H20N2O4S/c1-10-19-13(9-25-10)16-7-12(8-24-16)17(21)20-14-5-3-2-4-11(14)6-15(20)18(22)23/h7-9,11,14-15H,2-6H2,1H3,(H,22,23)/t11-,14+,15+/m1/s1 |
| InChIKey | JMLIWWBKUCCSGQ-UGFHNGPFSA-N |
| XLogP | 3.57 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |