C17H18N2O4S — CID 99849240
(2S,3aR,7aS)-1-[2-(furan-3-yl)-1,3-thiazole-4-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 99849240) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is (2S,3aR,7aS)-1-[2-(furan-3-yl)-1,3-thiazole-4-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | (2S,3aR,7aS)-1-[2-(furan-3-yl)-1,3-thiazole-4-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 99849240 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | (2S,3aR,7aS)-1-[2-(furan-3-yl)-1,3-thiazole-4-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H]2CCCC[C@@H]2N1C(=O)c1csc(-c2ccoc2)n1 |
| InChI | InChI=1S/C17H18N2O4S/c20-16(12-9-24-15(18-12)11-5-6-23-8-11)19-13-4-2-1-3-10(13)7-14(19)17(21)22/h5-6,8-10,13-14H,1-4,7H2,(H,21,22)/t10-,13+,14+/m1/s1 |
| InChIKey | YUAQKKNEDQDZBR-SWHYSGLUSA-N |
| XLogP | 3.26 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |