C23H26N6O2S2 — CID 70919477
(1R,2R,4S)-2-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-[(5-methyl-1,3-thiazol-2-yl)methylamino]pyrimidin-4-yl]amino]-4-(hydroxymethyl)cyclopentan-1-ol (PubChem CID 70919477) has the molecular formula C23H26N6O2S2 and a molecular weight of 482.64 g/mol. Its IUPAC name is (1R,2R,4S)-2-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-[(5-methyl-1,3-thiazol-2-yl)methylamino]pyrimidin-4-yl]amino]-4-(hydroxymethyl)cyclopentan-1-ol.
| Compound Name | (1R,2R,4S)-2-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-[(5-methyl-1,3-thiazol-2-yl)methylamino]pyrimidin-4-yl]amino]-4-(hydroxymethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 70919477 |
| Molecular Formula | C23H26N6O2S2 |
| Molecular Weight | 482.64 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | (1R,2R,4S)-2-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-[(5-methyl-1,3-thiazol-2-yl)methylamino]pyrimidin-4-yl]amino]-4-(hydroxymethyl)cyclopentan-1-ol |
| SMILES | Cc1cnc(CNc2nc(C)c(-c3nc4ccccc4s3)c(N[C@@H]3C[C@H](CO)C[C@H]3O)n2)s1 |
| InChI | InChI=1S/C23H26N6O2S2/c1-12-9-24-19(32-12)10-25-23-26-13(2)20(22-28-15-5-3-4-6-18(15)33-22)21(29-23)27-16-7-14(11-30)8-17(16)31/h3-6,9,14,16-17,30-31H,7-8,10-11H2,1-2H3,(H2,25,26,27,29)/t14-,16+,17+/m0/s1 |
| InChIKey | MZTCPJVVMRYUCD-USXIJHARSA-N |
| XLogP | 3.98 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.64 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |