C17H33N3O2 — CID 70920720
tert-butyl N-[(1S)-3-(4-methyl-1,4-diazepan-1-yl)cyclohexyl]carbamate (PubChem CID 70920720) has the molecular formula C17H33N3O2 and a molecular weight of 311.47 g/mol. Its IUPAC name is tert-butyl N-[(1S)-3-(4-methyl-1,4-diazepan-1-yl)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-3-(4-methyl-1,4-diazepan-1-yl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 70920720 |
| Molecular Formula | C17H33N3O2 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | tert-butyl N-[(1S)-3-(4-methyl-1,4-diazepan-1-yl)cyclohexyl]carbamate |
| SMILES | CN1CCCN(C2CCC[C@H](NC(=O)OC(C)(C)C)C2)CC1 |
| InChI | InChI=1S/C17H33N3O2/c1-17(2,3)22-16(21)18-14-7-5-8-15(13-14)20-10-6-9-19(4)11-12-20/h14-15H,5-13H2,1-4H3,(H,18,21)/t14-,15?/m0/s1 |
| InChIKey | OHIPMISJAJPYQF-MLCCFXAWSA-N |
| XLogP | 2.46 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |