C23H39N3O2 — CID 91363143
tert-butyl N-[3-(4-octa-3,5,7-trienylpiperazin-1-yl)cyclohexyl]carbamate (PubChem CID 91363143) has the molecular formula C23H39N3O2 and a molecular weight of 389.58 g/mol. Its IUPAC name is tert-butyl N-[3-(4-octa-3,5,7-trienylpiperazin-1-yl)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-octa-3,5,7-trienylpiperazin-1-yl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 91363143 |
| Molecular Formula | C23H39N3O2 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.30 |
| IUPAC Name | tert-butyl N-[3-(4-octa-3,5,7-trienylpiperazin-1-yl)cyclohexyl]carbamate |
| SMILES | C=CC=CC=CCCN1CCN(C2CCCC(NC(=O)OC(C)(C)C)C2)CC1 |
| InChI | InChI=1S/C23H39N3O2/c1-5-6-7-8-9-10-14-25-15-17-26(18-16-25)21-13-11-12-20(19-21)24-22(27)28-23(2,3)4/h5-9,20-21H,1,10-19H2,2-4H3,(H,24,27) |
| InChIKey | ZFDPOYPQYRJELC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|