C17H37N3O2 — CID 143651489
tert-butyl N-[1-[2-(dimethylamino)ethyl]azepan-4-yl]carbamate;ethane (PubChem CID 143651489) has the molecular formula C17H37N3O2 and a molecular weight of 315.50 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(dimethylamino)ethyl]azepan-4-yl]carbamate;ethane.
| Compound Name | tert-butyl N-[1-[2-(dimethylamino)ethyl]azepan-4-yl]carbamate;ethane |
|---|---|
| PubChem CID | 143651489 |
| Molecular Formula | C17H37N3O2 |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | tert-butyl N-[1-[2-(dimethylamino)ethyl]azepan-4-yl]carbamate;ethane |
| SMILES | CC.CN(C)CCN1CCCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H31N3O2.C2H6/c1-15(2,3)20-14(19)16-13-7-6-9-18(10-8-13)12-11-17(4)5;1-2/h13H,6-12H2,1-5H3,(H,16,19);1-2H3 |
| InChIKey | MHBIUTOYJUTTGQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |