C21H27N3O4S — CID 7092142
1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]piperidine-4-carboxamide (PubChem CID 7092142) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]piperidine-4-carboxamide.
| Compound Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 7092142 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]piperidine-4-carboxamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCC(C(=O)N[C@@H]2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C21H27N3O4S/c1-14-20(15(2)28-23-14)29(26,27)24-12-10-17(11-13-24)21(25)22-19-9-5-7-16-6-3-4-8-18(16)19/h3-4,6,8,17,19H,5,7,9-13H2,1-2H3,(H,22,25)/t19-/m1/s1 |
| InChIKey | DXDLEDWAIZEVEN-LJQANCHMSA-N |
| XLogP | 2.89 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |