C26H30N4O4S — CID 92715052
1-[2-methyl-5-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]sulfonyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]piperidine-4-carboxamide (PubChem CID 92715052) has the molecular formula C26H30N4O4S and a molecular weight of 494.62 g/mol. Its IUPAC name is 1-[2-methyl-5-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]sulfonyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]piperidine-4-carboxamide.
| Compound Name | 1-[2-methyl-5-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]sulfonyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 92715052 |
| Molecular Formula | C26H30N4O4S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 1-[2-methyl-5-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]sulfonyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]piperidine-4-carboxamide |
| SMILES | Cc1nc(-c2ccc(C)c(S(=O)(=O)N3CCC(C(=O)N[C@@H]4CCCc5ccccc54)CC3)c2)no1 |
| InChI | InChI=1S/C26H30N4O4S/c1-17-10-11-21(25-27-18(2)34-29-25)16-24(17)35(32,33)30-14-12-20(13-15-30)26(31)28-23-9-5-7-19-6-3-4-8-22(19)23/h3-4,6,8,10-11,16,20,23H,5,7,9,12-15H2,1-2H3,(H,28,31)/t23-/m1/s1 |
| InChIKey | NKJZPYBXDCLZQP-HSZRJFAPSA-N |
| XLogP | 3.95 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |