C16H13NO2 — CID 70923086
4-methoxy-4-quinolin-3-ylcyclohexa-2,5-dien-1-one (PubChem CID 70923086) has the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. Its IUPAC name is 4-methoxy-4-quinolin-3-ylcyclohexa-2,5-dien-1-one.
| Compound Name | 4-methoxy-4-quinolin-3-ylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 70923086 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 4-methoxy-4-quinolin-3-ylcyclohexa-2,5-dien-1-one |
| SMILES | COC1(c2cnc3ccccc3c2)C=CC(=O)C=C1 |
| InChI | InChI=1S/C16H13NO2/c1-19-16(8-6-14(18)7-9-16)13-10-12-4-2-3-5-15(12)17-11-13/h2-11H,1H3 |
| InChIKey | RVZGJMRXUFBKHF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |