C11H22N2O2 — CID 70923174
4-hydroxy-N,2,2,6,6-pentamethylpiperidine-4-carboxamide (PubChem CID 70923174) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 4-hydroxy-N,2,2,6,6-pentamethylpiperidine-4-carboxamide.
| Compound Name | 4-hydroxy-N,2,2,6,6-pentamethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 70923174 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 4-hydroxy-N,2,2,6,6-pentamethylpiperidine-4-carboxamide |
| SMILES | CNC(=O)C1(O)CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C11H22N2O2/c1-9(2)6-11(15,8(14)12-5)7-10(3,4)13-9/h13,15H,6-7H2,1-5H3,(H,12,14) |
| InChIKey | FSZIXNXUKHGYKG-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |