C25H28FN5 — CID 70924218
N'-[(7-fluoro-9H-pyrido[3,4-b]indol-1-yl)methyl]-N'-(5,6,7,8-tetrahydroquinolin-8-yl)butane-1,4-diamine (PubChem CID 70924218) has the molecular formula C25H28FN5 and a molecular weight of 417.53 g/mol. Its IUPAC name is N'-[(7-fluoro-9H-pyrido[3,4-b]indol-1-yl)methyl]-N'-(5,6,7,8-tetrahydroquinolin-8-yl)butane-1,4-diamine.
| Compound Name | N'-[(7-fluoro-9H-pyrido[3,4-b]indol-1-yl)methyl]-N'-(5,6,7,8-tetrahydroquinolin-8-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 70924218 |
| Molecular Formula | C25H28FN5 |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | N'-[(7-fluoro-9H-pyrido[3,4-b]indol-1-yl)methyl]-N'-(5,6,7,8-tetrahydroquinolin-8-yl)butane-1,4-diamine |
| SMILES | NCCCCN(Cc1nccc2c1[nH]c1cc(F)ccc12)C1CCCc2cccnc21 |
| InChI | InChI=1S/C25H28FN5/c26-18-8-9-19-20-10-13-28-22(25(20)30-21(19)15-18)16-31(14-2-1-11-27)23-7-3-5-17-6-4-12-29-24(17)23/h4,6,8-10,12-13,15,23,30H,1-3,5,7,11,14,16,27H2 |
| InChIKey | GQVVKVDNSZUCRF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|