C24H42O6 — CID 70926789
(2R,3R)-2,3-bis[(4-tert-butylcyclohexyl)oxy]butanedioic acid (PubChem CID 70926789) has the molecular formula C24H42O6 and a molecular weight of 426.59 g/mol. Its IUPAC name is (2R,3R)-2,3-bis[(4-tert-butylcyclohexyl)oxy]butanedioic acid.
| Compound Name | (2R,3R)-2,3-bis[(4-tert-butylcyclohexyl)oxy]butanedioic acid |
|---|---|
| PubChem CID | 70926789 |
| Molecular Formula | C24H42O6 |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | (2R,3R)-2,3-bis[(4-tert-butylcyclohexyl)oxy]butanedioic acid |
| SMILES | CC(C)(C)C1CCC(O[C@@H](C(=O)O)[C@@H](OC2CCC(C(C)(C)C)CC2)C(=O)O)CC1 |
| InChI | InChI=1S/C24H42O6/c1-23(2,3)15-7-11-17(12-8-15)29-19(21(25)26)20(22(27)28)30-18-13-9-16(10-14-18)24(4,5)6/h15-20H,7-14H2,1-6H3,(H,25,26)(H,27,28)/t15?,16?,17?,18?,19-,20-/m1/s1 |
| InChIKey | CNKFIDIHEQRCAC-MHUBRMLGSA-N |
| XLogP | 5.14 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |