C15H17NO3 — CID 70926976
1-(furan-2-yl)-3-[(2-hydroxy-2-phenylethyl)amino]propan-1-one (PubChem CID 70926976) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 1-(furan-2-yl)-3-[(2-hydroxy-2-phenylethyl)amino]propan-1-one.
| Compound Name | 1-(furan-2-yl)-3-[(2-hydroxy-2-phenylethyl)amino]propan-1-one |
|---|---|
| PubChem CID | 70926976 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1-(furan-2-yl)-3-[(2-hydroxy-2-phenylethyl)amino]propan-1-one |
| SMILES | O=C(CCNCC(O)c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C15H17NO3/c17-13(15-7-4-10-19-15)8-9-16-11-14(18)12-5-2-1-3-6-12/h1-7,10,14,16,18H,8-9,11H2 |
| InChIKey | ZSUIWLMWQGXEBG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|