C18H18F3N5O3S — CID 70927246
3-[2-(2-methoxyethylamino)-4-(2,2,2-trifluoroethylamino)pyrido[3,2-d]pyrimidin-6-yl]benzenesulfinic acid (PubChem CID 70927246) has the molecular formula C18H18F3N5O3S and a molecular weight of 441.44 g/mol. Its IUPAC name is 3-[2-(2-methoxyethylamino)-4-(2,2,2-trifluoroethylamino)pyrido[3,2-d]pyrimidin-6-yl]benzenesulfinic acid.
| Compound Name | 3-[2-(2-methoxyethylamino)-4-(2,2,2-trifluoroethylamino)pyrido[3,2-d]pyrimidin-6-yl]benzenesulfinic acid |
|---|---|
| PubChem CID | 70927246 |
| Molecular Formula | C18H18F3N5O3S |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 3-[2-(2-methoxyethylamino)-4-(2,2,2-trifluoroethylamino)pyrido[3,2-d]pyrimidin-6-yl]benzenesulfinic acid |
| SMILES | COCCNc1nc(NCC(F)(F)F)c2nc(-c3cccc(S(=O)O)c3)ccc2n1 |
| InChI | InChI=1S/C18H18F3N5O3S/c1-29-8-7-22-17-25-14-6-5-13(11-3-2-4-12(9-11)30(27)28)24-15(14)16(26-17)23-10-18(19,20)21/h2-6,9H,7-8,10H2,1H3,(H,27,28)(H2,22,23,25,26) |
| InChIKey | RXZRKKBFUYPZMQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 109.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|