C23H25BrN2O2 — CID 70927898
ethyl (2E)-2-[(3S)-7-bromo-1-ethyl-3-methyl-5-phenyl-3H-1,4-benzodiazepin-2-ylidene]propanoate (PubChem CID 70927898) has the molecular formula C23H25BrN2O2 and a molecular weight of 441.37 g/mol. Its IUPAC name is ethyl (2E)-2-[(3S)-7-bromo-1-ethyl-3-methyl-5-phenyl-3H-1,4-benzodiazepin-2-ylidene]propanoate.
| Compound Name | ethyl (2E)-2-[(3S)-7-bromo-1-ethyl-3-methyl-5-phenyl-3H-1,4-benzodiazepin-2-ylidene]propanoate |
|---|---|
| PubChem CID | 70927898 |
| Molecular Formula | C23H25BrN2O2 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | ethyl (2E)-2-[(3S)-7-bromo-1-ethyl-3-methyl-5-phenyl-3H-1,4-benzodiazepin-2-ylidene]propanoate |
| SMILES | CCOC(=O)/C(C)=C1\[C@H](C)N=C(c2ccccc2)c2cc(Br)ccc2N1CC |
| InChI | InChI=1S/C23H25BrN2O2/c1-5-26-20-13-12-18(24)14-19(20)21(17-10-8-7-9-11-17)25-16(4)22(26)15(3)23(27)28-6-2/h7-14,16H,5-6H2,1-4H3/b22-15+/t16-/m0/s1 |
| InChIKey | VOOQSKLCYTXDIZ-PZBNQXIHSA-N |
| XLogP | 5.35 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|