C24H27N3O2Si — CID 70827639
ethyl (4R)-4-methyl-6-phenyl-8-trimethylsilyl-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate (PubChem CID 70827639) has the molecular formula C24H27N3O2Si and a molecular weight of 417.59 g/mol. Its IUPAC name is ethyl (4R)-4-methyl-6-phenyl-8-trimethylsilyl-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate.
| Compound Name | ethyl (4R)-4-methyl-6-phenyl-8-trimethylsilyl-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate |
|---|---|
| PubChem CID | 70827639 |
| Molecular Formula | C24H27N3O2Si |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | ethyl (4R)-4-methyl-6-phenyl-8-trimethylsilyl-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate |
| SMILES | CCOC(=O)c1ncn2c1[C@@H](C)N=C(c1ccccc1)c1cc([Si](C)(C)C)ccc1-2 |
| InChI | InChI=1S/C24H27N3O2Si/c1-6-29-24(28)22-23-16(2)26-21(17-10-8-7-9-11-17)19-14-18(30(3,4)5)12-13-20(19)27(23)15-25-22/h7-16H,6H2,1-5H3/t16-/m1/s1 |
| InChIKey | WUBSJVZHBCTGGW-MRXNPFEDSA-N |
| XLogP | 4.51 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|