C26H38N2O6S — CID 70930667
tert-butyl N-[3-butoxy-4-[(4-methoxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate (PubChem CID 70930667) has the molecular formula C26H38N2O6S and a molecular weight of 506.67 g/mol. Its IUPAC name is tert-butyl N-[3-butoxy-4-[(4-methoxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-butoxy-4-[(4-methoxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 70930667 |
| Molecular Formula | C26H38N2O6S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | tert-butyl N-[3-butoxy-4-[(4-methoxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate |
| SMILES | CCCCOC(CNS(=O)(=O)c1ccc(OC)cc1)C(Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H38N2O6S/c1-6-7-17-33-24(19-27-35(30,31)22-15-13-21(32-5)14-16-22)23(18-20-11-9-8-10-12-20)28-25(29)34-26(2,3)4/h8-16,23-24,27H,6-7,17-19H2,1-5H3,(H,28,29) |
| InChIKey | DRKMDGQPLZSUNM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|