C29H42N2O7S — CID 69224845
tert-butyl N-[(2S,3R)-4-(cyclohexylmethoxy)-3-hydroxy-4-[(4-methoxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate (PubChem CID 69224845) has the molecular formula C29H42N2O7S and a molecular weight of 562.73 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-4-(cyclohexylmethoxy)-3-hydroxy-4-[(4-methoxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-4-(cyclohexylmethoxy)-3-hydroxy-4-[(4-methoxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 69224845 |
| Molecular Formula | C29H42N2O7S |
| Molecular Weight | 562.73 g/mol |
| Exact Mass | 562.27 |
| IUPAC Name | tert-butyl N-[(2S,3R)-4-(cyclohexylmethoxy)-3-hydroxy-4-[(4-methoxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)NC(OCC2CCCCC2)[C@H](O)[C@H](Cc2ccccc2)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C29H42N2O7S/c1-29(2,3)38-28(33)30-25(19-21-11-7-5-8-12-21)26(32)27(37-20-22-13-9-6-10-14-22)31-39(34,35)24-17-15-23(36-4)16-18-24/h5,7-8,11-12,15-18,22,25-27,31-32H,6,9-10,13-14,19-20H2,1-4H3,(H,30,33)/t25-,26+,27?/m0/s1 |
| InChIKey | HDEFDWODAJFIGQ-AJRFNQODSA-N |
| XLogP | 4.39 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.73 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|