C27H38N2O7S — CID 22997210
tert-butyl N-[4-cyclopentyloxy-3-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate (PubChem CID 22997210) has the molecular formula C27H38N2O7S and a molecular weight of 534.68 g/mol. Its IUPAC name is tert-butyl N-[4-cyclopentyloxy-3-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-cyclopentyloxy-3-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 22997210 |
| Molecular Formula | C27H38N2O7S |
| Molecular Weight | 534.68 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | tert-butyl N-[4-cyclopentyloxy-3-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)NC(Cc2ccccc2)(NC(=O)OC(C)(C)C)C(O)COC2CCCC2)cc1 |
| InChI | InChI=1S/C27H38N2O7S/c1-26(2,3)36-25(31)28-27(18-20-10-6-5-7-11-20,24(30)19-35-22-12-8-9-13-22)29-37(32,33)23-16-14-21(34-4)15-17-23/h5-7,10-11,14-17,22,24,29-30H,8-9,12-13,18-19H2,1-4H3,(H,28,31) |
| InChIKey | KJQWRKSWGRVZMW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.68 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|