C33H47N3O10S — CID 91125950
ethyl N-[(6R,7S)-7-[[(3aR,4S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxycarbonylamino]-6-hydroxy-7-[(4-methoxyphenyl)sulfonylamino]-3,3-dimethyl-8-phenyloctyl]carbamate (PubChem CID 91125950) has the molecular formula C33H47N3O10S and a molecular weight of 677.82 g/mol. Its IUPAC name is ethyl N-[(6R,7S)-7-[[(3aR,4S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxycarbonylamino]-6-hydroxy-7-[(4-methoxyphenyl)sulfonylamino]-3,3-dimethyl-8-phenyloctyl]carbamate.
| Compound Name | ethyl N-[(6R,7S)-7-[[(3aR,4S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxycarbonylamino]-6-hydroxy-7-[(4-methoxyphenyl)sulfonylamino]-3,3-dimethyl-8-phenyloctyl]carbamate |
|---|---|
| PubChem CID | 91125950 |
| Molecular Formula | C33H47N3O10S |
| Molecular Weight | 677.82 g/mol |
| Exact Mass | 677.30 |
| IUPAC Name | ethyl N-[(6R,7S)-7-[[(3aR,4S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxycarbonylamino]-6-hydroxy-7-[(4-methoxyphenyl)sulfonylamino]-3,3-dimethyl-8-phenyloctyl]carbamate |
| SMILES | CCOC(=O)NCCC(C)(C)CC[C@@H](O)[C@@](Cc1ccccc1)(NC(=O)O[C@@H]1CO[C@@H]2OCC[C@@H]21)NS(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C33H47N3O10S/c1-5-43-30(38)34-19-18-32(2,3)17-15-28(37)33(21-23-9-7-6-8-10-23,36-47(40,41)25-13-11-24(42-4)12-14-25)35-31(39)46-27-22-45-29-26(27)16-20-44-29/h6-14,26-29,36-37H,5,15-22H2,1-4H3,(H,34,38)(H,35,39)/t26-,27-,28-,29+,33+/m1/s1 |
| InChIKey | PJAIFOZZSXFYGA-LBULEFPHSA-N |
| XLogP | 3.70 |
| TPSA | 170.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.82 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|