C30H43N3O8S — CID 87889654
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-2-[[3-(4-amino-2,2-dimethylbutyl)-4-methoxyphenyl]sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 87889654) has the molecular formula C30H43N3O8S and a molecular weight of 605.75 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-2-[[3-(4-amino-2,2-dimethylbutyl)-4-methoxyphenyl]sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-2-[[3-(4-amino-2,2-dimethylbutyl)-4-methoxyphenyl]sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 87889654 |
| Molecular Formula | C30H43N3O8S |
| Molecular Weight | 605.75 g/mol |
| Exact Mass | 605.28 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-2-[[3-(4-amino-2,2-dimethylbutyl)-4-methoxyphenyl]sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N[C@](Cc2ccccc2)(NC(=O)OC2COC3OCCC23)[C@@H](C)O)cc1CC(C)(C)CCN |
| InChI | InChI=1S/C30H43N3O8S/c1-20(34)30(17-21-8-6-5-7-9-21,32-28(35)41-26-19-40-27-24(26)12-15-39-27)33-42(36,37)23-10-11-25(38-4)22(16-23)18-29(2,3)13-14-31/h5-11,16,20,24,26-27,33-34H,12-15,17-19,31H2,1-4H3,(H,32,35)/t20-,24?,26?,27?,30+/m1/s1 |
| InChIKey | MQPWMAXDIFFIKH-GREGKVEESA-N |
| XLogP | 2.70 |
| TPSA | 158.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.75 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|