C32H45N3O9S — CID 91074904
[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(1S,2R)-1-[benzyl-[3-(2,2-dimethyl-5-nitrosohexyl)-4-methoxyphenyl]sulfonylamino]-2-hydroxypropyl]carbamate (PubChem CID 91074904) has the molecular formula C32H45N3O9S and a molecular weight of 647.79 g/mol. Its IUPAC name is [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(1S,2R)-1-[benzyl-[3-(2,2-dimethyl-5-nitrosohexyl)-4-methoxyphenyl]sulfonylamino]-2-hydroxypropyl]carbamate.
| Compound Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(1S,2R)-1-[benzyl-[3-(2,2-dimethyl-5-nitrosohexyl)-4-methoxyphenyl]sulfonylamino]-2-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 91074904 |
| Molecular Formula | C32H45N3O9S |
| Molecular Weight | 647.79 g/mol |
| Exact Mass | 647.29 |
| IUPAC Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(1S,2R)-1-[benzyl-[3-(2,2-dimethyl-5-nitrosohexyl)-4-methoxyphenyl]sulfonylamino]-2-hydroxypropyl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccccc2)[C@H](NC(=O)O[C@H]2CO[C@H]3OCC[C@H]32)[C@@H](C)O)cc1CC(C)(C)CCC(C)N=O |
| InChI | InChI=1S/C32H45N3O9S/c1-21(34-38)13-15-32(3,4)18-24-17-25(11-12-27(24)41-5)45(39,40)35(19-23-9-7-6-8-10-23)29(22(2)36)33-31(37)44-28-20-43-30-26(28)14-16-42-30/h6-12,17,21-22,26,28-30,36H,13-16,18-20H2,1-5H3,(H,33,37)/t21?,22-,26+,28+,29+,30-/m1/s1 |
| InChIKey | NKNVVJDQNBMWEK-SXZYXZDESA-N |
| XLogP | 4.58 |
| TPSA | 153.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.79 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|