C30H42N2O8S — CID 70130694
[(3S)-oxolan-3-yl] N-[(2R)-1-[benzyl-[3-(2,2-dimethyl-5-oxohexyl)-4-methoxyphenyl]sulfonylamino]-2-hydroxypropyl]carbamate (PubChem CID 70130694) has the molecular formula C30H42N2O8S and a molecular weight of 590.74 g/mol. Its IUPAC name is [(3S)-oxolan-3-yl] N-[(2R)-1-[benzyl-[3-(2,2-dimethyl-5-oxohexyl)-4-methoxyphenyl]sulfonylamino]-2-hydroxypropyl]carbamate.
| Compound Name | [(3S)-oxolan-3-yl] N-[(2R)-1-[benzyl-[3-(2,2-dimethyl-5-oxohexyl)-4-methoxyphenyl]sulfonylamino]-2-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 70130694 |
| Molecular Formula | C30H42N2O8S |
| Molecular Weight | 590.74 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | [(3S)-oxolan-3-yl] N-[(2R)-1-[benzyl-[3-(2,2-dimethyl-5-oxohexyl)-4-methoxyphenyl]sulfonylamino]-2-hydroxypropyl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccccc2)C(NC(=O)O[C@H]2CCOC2)[C@@H](C)O)cc1CC(C)(C)CCC(C)=O |
| InChI | InChI=1S/C30H42N2O8S/c1-21(33)13-15-30(3,4)18-24-17-26(11-12-27(24)38-5)41(36,37)32(19-23-9-7-6-8-10-23)28(22(2)34)31-29(35)40-25-14-16-39-20-25/h6-12,17,22,25,28,34H,13-16,18-20H2,1-5H3,(H,31,35)/t22-,25+,28?/m1/s1 |
| InChIKey | CFFGRPDMQXLHGR-NISFJFIFSA-N |
| XLogP | 4.05 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.74 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|