C24H31N3O6S — CID 21356813
[(1S,2R)-1-[benzyl-[3-(4-cyano-2-methylbutyl)-4-methoxyphenyl]sulfonylamino]-2-hydroxypropyl]carbamic acid (PubChem CID 21356813) has the molecular formula C24H31N3O6S and a molecular weight of 489.59 g/mol. Its IUPAC name is [(1S,2R)-1-[benzyl-[3-(4-cyano-2-methylbutyl)-4-methoxyphenyl]sulfonylamino]-2-hydroxypropyl]carbamic acid.
| Compound Name | [(1S,2R)-1-[benzyl-[3-(4-cyano-2-methylbutyl)-4-methoxyphenyl]sulfonylamino]-2-hydroxypropyl]carbamic acid |
|---|---|
| PubChem CID | 21356813 |
| Molecular Formula | C24H31N3O6S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | [(1S,2R)-1-[benzyl-[3-(4-cyano-2-methylbutyl)-4-methoxyphenyl]sulfonylamino]-2-hydroxypropyl]carbamic acid |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccccc2)[C@H](NC(=O)O)[C@@H](C)O)cc1CC(C)CCC#N |
| InChI | InChI=1S/C24H31N3O6S/c1-17(8-7-13-25)14-20-15-21(11-12-22(20)33-3)34(31,32)27(16-19-9-5-4-6-10-19)23(18(2)28)26-24(29)30/h4-6,9-12,15,17-18,23,26,28H,7-8,14,16H2,1-3H3,(H,29,30)/t17?,18-,23+/m1/s1 |
| InChIKey | RMLDRHUYCYTWQK-GTGLXDFNSA-N |
| XLogP | 3.34 |
| TPSA | 139.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|