C25H36N2O6S — CID 69224584
tert-butyl N-[(1S,2R)-1-[benzyl-[3-[(2-methylpropan-2-yl)oxy]phenyl]sulfonylamino]-2-hydroxypropyl]carbamate (PubChem CID 69224584) has the molecular formula C25H36N2O6S and a molecular weight of 492.64 g/mol. Its IUPAC name is tert-butyl N-[(1S,2R)-1-[benzyl-[3-[(2-methylpropan-2-yl)oxy]phenyl]sulfonylamino]-2-hydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2R)-1-[benzyl-[3-[(2-methylpropan-2-yl)oxy]phenyl]sulfonylamino]-2-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 69224584 |
| Molecular Formula | C25H36N2O6S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | tert-butyl N-[(1S,2R)-1-[benzyl-[3-[(2-methylpropan-2-yl)oxy]phenyl]sulfonylamino]-2-hydroxypropyl]carbamate |
| SMILES | C[C@@H](O)[C@@H](NC(=O)OC(C)(C)C)N(Cc1ccccc1)S(=O)(=O)c1cccc(OC(C)(C)C)c1 |
| InChI | InChI=1S/C25H36N2O6S/c1-18(28)22(26-23(29)33-25(5,6)7)27(17-19-12-9-8-10-13-19)34(30,31)21-15-11-14-20(16-21)32-24(2,3)4/h8-16,18,22,28H,17H2,1-7H3,(H,26,29)/t18-,22+/m1/s1 |
| InChIKey | VOESOKKOHMPSNQ-GCJKJVERSA-N |
| XLogP | 4.29 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|