C27H36N2O9S — CID 70034892
1,3-dioxan-5-yl N-[1-[benzyl-(3-cyclopentyloxy-4-methoxyphenyl)sulfonylamino]-2-hydroxypropyl]carbamate (PubChem CID 70034892) has the molecular formula C27H36N2O9S and a molecular weight of 564.66 g/mol. Its IUPAC name is 1,3-dioxan-5-yl N-[1-[benzyl-(3-cyclopentyloxy-4-methoxyphenyl)sulfonylamino]-2-hydroxypropyl]carbamate.
| Compound Name | 1,3-dioxan-5-yl N-[1-[benzyl-(3-cyclopentyloxy-4-methoxyphenyl)sulfonylamino]-2-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 70034892 |
| Molecular Formula | C27H36N2O9S |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | 1,3-dioxan-5-yl N-[1-[benzyl-(3-cyclopentyloxy-4-methoxyphenyl)sulfonylamino]-2-hydroxypropyl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccccc2)C(NC(=O)OC2COCOC2)C(C)O)cc1OC1CCCC1 |
| InChI | InChI=1S/C27H36N2O9S/c1-19(30)26(28-27(31)38-22-16-35-18-36-17-22)29(15-20-8-4-3-5-9-20)39(32,33)23-12-13-24(34-2)25(14-23)37-21-10-6-7-11-21/h3-5,8-9,12-14,19,21-22,26,30H,6-7,10-11,15-18H2,1-2H3,(H,28,31) |
| InChIKey | TVXRBJSJRCSFMV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|