C31H43N3O10S — CID 91280842
[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-8-carbamoyloxy-3-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]-6,6-dimethyl-1-phenyloctan-2-yl]carbamate (PubChem CID 91280842) has the molecular formula C31H43N3O10S and a molecular weight of 649.76 g/mol. Its IUPAC name is [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-8-carbamoyloxy-3-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]-6,6-dimethyl-1-phenyloctan-2-yl]carbamate.
| Compound Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-8-carbamoyloxy-3-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]-6,6-dimethyl-1-phenyloctan-2-yl]carbamate |
|---|---|
| PubChem CID | 91280842 |
| Molecular Formula | C31H43N3O10S |
| Molecular Weight | 649.76 g/mol |
| Exact Mass | 649.27 |
| IUPAC Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-8-carbamoyloxy-3-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]-6,6-dimethyl-1-phenyloctan-2-yl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N[C@](Cc2ccccc2)(NC(=O)O[C@H]2CO[C@H]3OCC[C@H]32)[C@H](O)CCC(C)(C)CCOC(N)=O)cc1 |
| InChI | InChI=1S/C31H43N3O10S/c1-30(2,16-18-42-28(32)36)15-13-26(35)31(19-21-7-5-4-6-8-21,34-45(38,39)23-11-9-22(40-3)10-12-23)33-29(37)44-25-20-43-27-24(25)14-17-41-27/h4-12,24-27,34-35H,13-20H2,1-3H3,(H2,32,36)(H,33,37)/t24-,25-,26+,27+,31-/m0/s1 |
| InChIKey | KEYDZLFIFWKTMF-OVHWAJSJSA-N |
| XLogP | 3.05 |
| TPSA | 184.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.76 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|