C30H43N3O6S — CID 22996511
tert-butyl N-[9-cyano-3-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]-6,6-dimethyl-1-phenylnonan-2-yl]carbamate (PubChem CID 22996511) has the molecular formula C30H43N3O6S and a molecular weight of 573.76 g/mol. Its IUPAC name is tert-butyl N-[9-cyano-3-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]-6,6-dimethyl-1-phenylnonan-2-yl]carbamate.
| Compound Name | tert-butyl N-[9-cyano-3-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]-6,6-dimethyl-1-phenylnonan-2-yl]carbamate |
|---|---|
| PubChem CID | 22996511 |
| Molecular Formula | C30H43N3O6S |
| Molecular Weight | 573.76 g/mol |
| Exact Mass | 573.29 |
| IUPAC Name | tert-butyl N-[9-cyano-3-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]-6,6-dimethyl-1-phenylnonan-2-yl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)NC(Cc2ccccc2)(NC(=O)OC(C)(C)C)C(O)CCC(C)(C)CCCC#N)cc1 |
| InChI | InChI=1S/C30H43N3O6S/c1-28(2,3)39-27(35)32-30(22-23-12-8-7-9-13-23,26(34)18-20-29(4,5)19-10-11-21-31)33-40(36,37)25-16-14-24(38-6)15-17-25/h7-9,12-17,26,33-34H,10-11,18-20,22H2,1-6H3,(H,32,35) |
| InChIKey | SFUNQRWVCURKSR-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 137.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.76 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|