C24H29F3N2O7S — CID 87741017
[(2S,3R)-2-amino-4-[cyclopentyloxy-(4-methoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl] 2,2,2-trifluoroacetate (PubChem CID 87741017) has the molecular formula C24H29F3N2O7S and a molecular weight of 546.56 g/mol. Its IUPAC name is [(2S,3R)-2-amino-4-[cyclopentyloxy-(4-methoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(2S,3R)-2-amino-4-[cyclopentyloxy-(4-methoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87741017 |
| Molecular Formula | C24H29F3N2O7S |
| Molecular Weight | 546.56 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | [(2S,3R)-2-amino-4-[cyclopentyloxy-(4-methoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl] 2,2,2-trifluoroacetate |
| SMILES | COc1ccc(S(=O)(=O)N(C[C@@H](O)[C@](N)(Cc2ccccc2)OC(=O)C(F)(F)F)OC2CCCC2)cc1 |
| InChI | InChI=1S/C24H29F3N2O7S/c1-34-18-11-13-20(14-12-18)37(32,33)29(36-19-9-5-6-10-19)16-21(30)23(28,35-22(31)24(25,26)27)15-17-7-3-2-4-8-17/h2-4,7-8,11-14,19,21,30H,5-6,9-10,15-16,28H2,1H3/t21-,23+/m1/s1 |
| InChIKey | OFXPRCZXTLYZEW-GGAORHGYSA-N |
| XLogP | 2.92 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.56 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|