C25H34N2O7S — CID 59090611
N-[3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(oxan-2-ylmethoxy)amino]-1-phenylbutan-2-yl]acetamide (PubChem CID 59090611) has the molecular formula C25H34N2O7S and a molecular weight of 506.62 g/mol. Its IUPAC name is N-[3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(oxan-2-ylmethoxy)amino]-1-phenylbutan-2-yl]acetamide.
| Compound Name | N-[3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(oxan-2-ylmethoxy)amino]-1-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 59090611 |
| Molecular Formula | C25H34N2O7S |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | N-[3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(oxan-2-ylmethoxy)amino]-1-phenylbutan-2-yl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(O)C(Cc2ccccc2)NC(C)=O)OCC2CCCCO2)cc1 |
| InChI | InChI=1S/C25H34N2O7S/c1-19(28)26-24(16-20-8-4-3-5-9-20)25(29)17-27(34-18-22-10-6-7-15-33-22)35(30,31)23-13-11-21(32-2)12-14-23/h3-5,8-9,11-14,22,24-25,29H,6-7,10,15-18H2,1-2H3,(H,26,28) |
| InChIKey | QDGYJTNZNJZBCX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|