C26H36N2O8S — CID 69222762
[(3S)-oxolan-3-yl] N-[(2S,3R)-4-butan-2-yloxy-3-hydroxy-4-[(4-methoxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate (PubChem CID 69222762) has the molecular formula C26H36N2O8S and a molecular weight of 536.65 g/mol. Its IUPAC name is [(3S)-oxolan-3-yl] N-[(2S,3R)-4-butan-2-yloxy-3-hydroxy-4-[(4-methoxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(3S)-oxolan-3-yl] N-[(2S,3R)-4-butan-2-yloxy-3-hydroxy-4-[(4-methoxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 69222762 |
| Molecular Formula | C26H36N2O8S |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | [(3S)-oxolan-3-yl] N-[(2S,3R)-4-butan-2-yloxy-3-hydroxy-4-[(4-methoxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate |
| SMILES | CCC(C)OC(NS(=O)(=O)c1ccc(OC)cc1)[C@H](O)[C@H](Cc1ccccc1)NC(=O)O[C@H]1CCOC1 |
| InChI | InChI=1S/C26H36N2O8S/c1-4-18(2)35-25(28-37(31,32)22-12-10-20(33-3)11-13-22)24(29)23(16-19-8-6-5-7-9-19)27-26(30)36-21-14-15-34-17-21/h5-13,18,21,23-25,28-29H,4,14-17H2,1-3H3,(H,27,30)/t18?,21-,23-,24+,25?/m0/s1 |
| InChIKey | JHSZTMMACXDIEQ-AZBRQXRYSA-N |
| XLogP | 2.60 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|