C24H27N3O6 — CID 70931033
(2R,3R)-4-(1,3-dihydroisoindol-2-yl)-2,3-dihydroxy-N-[[4-[(2-methoxyphenyl)methyl]-4,5-dihydro-1,3-oxazol-2-yl]methyl]-4-oxobutanamide (PubChem CID 70931033) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is (2R,3R)-4-(1,3-dihydroisoindol-2-yl)-2,3-dihydroxy-N-[[4-[(2-methoxyphenyl)methyl]-4,5-dihydro-1,3-oxazol-2-yl]methyl]-4-oxobutanamide.
| Compound Name | (2R,3R)-4-(1,3-dihydroisoindol-2-yl)-2,3-dihydroxy-N-[[4-[(2-methoxyphenyl)methyl]-4,5-dihydro-1,3-oxazol-2-yl]methyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 70931033 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | (2R,3R)-4-(1,3-dihydroisoindol-2-yl)-2,3-dihydroxy-N-[[4-[(2-methoxyphenyl)methyl]-4,5-dihydro-1,3-oxazol-2-yl]methyl]-4-oxobutanamide |
| SMILES | COc1ccccc1CC1COC(CNC(=O)[C@H](O)[C@@H](O)C(=O)N2Cc3ccccc3C2)=N1 |
| InChI | InChI=1S/C24H27N3O6/c1-32-19-9-5-4-6-15(19)10-18-14-33-20(26-18)11-25-23(30)21(28)22(29)24(31)27-12-16-7-2-3-8-17(16)13-27/h2-9,18,21-22,28-29H,10-14H2,1H3,(H,25,30)/t18?,21-,22-/m1/s1 |
| InChIKey | DGIMZUWLDWLLLA-IPKCRJEZSA-N |
| XLogP | 0.42 |
| TPSA | 120.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |