C24H29N3O4S — CID 143153804
(2R,3R)-4-(1,3-dihydroisoindol-2-yl)-2,3-dihydroxy-4-oxo-N-[(1-phenylsulfanylpiperidin-4-yl)methyl]butanamide (PubChem CID 143153804) has the molecular formula C24H29N3O4S and a molecular weight of 455.58 g/mol. Its IUPAC name is (2R,3R)-4-(1,3-dihydroisoindol-2-yl)-2,3-dihydroxy-4-oxo-N-[(1-phenylsulfanylpiperidin-4-yl)methyl]butanamide.
| Compound Name | (2R,3R)-4-(1,3-dihydroisoindol-2-yl)-2,3-dihydroxy-4-oxo-N-[(1-phenylsulfanylpiperidin-4-yl)methyl]butanamide |
|---|---|
| PubChem CID | 143153804 |
| Molecular Formula | C24H29N3O4S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | (2R,3R)-4-(1,3-dihydroisoindol-2-yl)-2,3-dihydroxy-4-oxo-N-[(1-phenylsulfanylpiperidin-4-yl)methyl]butanamide |
| SMILES | O=C(NCC1CCN(Sc2ccccc2)CC1)[C@H](O)[C@@H](O)C(=O)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C24H29N3O4S/c28-21(22(29)24(31)26-15-18-6-4-5-7-19(18)16-26)23(30)25-14-17-10-12-27(13-11-17)32-20-8-2-1-3-9-20/h1-9,17,21-22,28-29H,10-16H2,(H,25,30)/t21-,22-/m1/s1 |
| InChIKey | RVHCJBKREDAYFG-FGZHOGPDSA-N |
| XLogP | 1.79 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|