C17H19ClN4O — CID 70935792
10-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-6-chloro-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one (PubChem CID 70935792) has the molecular formula C17H19ClN4O and a molecular weight of 330.82 g/mol. Its IUPAC name is 10-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-6-chloro-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one.
| Compound Name | 10-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-6-chloro-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 70935792 |
| Molecular Formula | C17H19ClN4O |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 10-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-6-chloro-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
| SMILES | O=C1c2cc(Cl)cc3ncn(c23)CCN1[C@@H]1CN2CCC1CC2 |
| InChI | InChI=1S/C17H19ClN4O/c18-12-7-13-16-14(8-12)19-10-21(16)5-6-22(17(13)23)15-9-20-3-1-11(15)2-4-20/h7-8,10-11,15H,1-6,9H2/t15-/m1/s1 |
| InChIKey | UIKSKJCFFCXCTP-OAHLLOKOSA-N |
| XLogP | 2.24 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |