C16H17FN6O — CID 7093967
N'-[7-[(1S)-1-(3-fluorophenoxy)ethyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 7093967) has the molecular formula C16H17FN6O and a molecular weight of 328.35 g/mol. Its IUPAC name is N'-[7-[(1S)-1-(3-fluorophenoxy)ethyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[7-[(1S)-1-(3-fluorophenoxy)ethyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 7093967 |
| Molecular Formula | C16H17FN6O |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | N'-[7-[(1S)-1-(3-fluorophenoxy)ethyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | C[C@H](Oc1cccc(F)c1)c1ccnc2nc(N=CN(C)C)nn12 |
| InChI | InChI=1S/C16H17FN6O/c1-11(24-13-6-4-5-12(17)9-13)14-7-8-18-16-20-15(21-23(14)16)19-10-22(2)3/h4-11H,1-3H3/t11-/m0/s1 |
| InChIKey | MNZCEZOYFDJLDX-NSHDSACASA-N |
| XLogP | 2.62 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|