C29H30ClNO5 — CID 70943131
4-[[6-chloro-4-[(Z)-1-hydroxybut-1-enyl]-3,4-dihydro-2H-chromen-7-yl]oxy]-N-[2-(2-methoxyphenyl)ethyl]benzamide (PubChem CID 70943131) has the molecular formula C29H30ClNO5 and a molecular weight of 508.01 g/mol. Its IUPAC name is 4-[[6-chloro-4-[(Z)-1-hydroxybut-1-enyl]-3,4-dihydro-2H-chromen-7-yl]oxy]-N-[2-(2-methoxyphenyl)ethyl]benzamide.
| Compound Name | 4-[[6-chloro-4-[(Z)-1-hydroxybut-1-enyl]-3,4-dihydro-2H-chromen-7-yl]oxy]-N-[2-(2-methoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 70943131 |
| Molecular Formula | C29H30ClNO5 |
| Molecular Weight | 508.01 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 4-[[6-chloro-4-[(Z)-1-hydroxybut-1-enyl]-3,4-dihydro-2H-chromen-7-yl]oxy]-N-[2-(2-methoxyphenyl)ethyl]benzamide |
| SMILES | CC/C=C(\O)C1CCOc2cc(Oc3ccc(C(=O)NCCc4ccccc4OC)cc3)c(Cl)cc21 |
| InChI | InChI=1S/C29H30ClNO5/c1-3-6-25(32)22-14-16-35-27-18-28(24(30)17-23(22)27)36-21-11-9-20(10-12-21)29(33)31-15-13-19-7-4-5-8-26(19)34-2/h4-12,17-18,22,32H,3,13-16H2,1-2H3,(H,31,33)/b25-6- |
| InChIKey | GXKKJJROCCTRKP-HGBQSQDTSA-N |
| XLogP | 6.83 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.01 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|