C27H27F4N5O4S — CID 70944099
ethyl (Z)-4-(dimethylamino)-2-[5-[6-(ethylcarbamoylamino)-4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-3-pyridinyl]-2-fluorobenzoyl]but-2-enoate (PubChem CID 70944099) has the molecular formula C27H27F4N5O4S and a molecular weight of 593.60 g/mol. Its IUPAC name is ethyl (Z)-4-(dimethylamino)-2-[5-[6-(ethylcarbamoylamino)-4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-3-pyridinyl]-2-fluorobenzoyl]but-2-enoate.
| Compound Name | ethyl (Z)-4-(dimethylamino)-2-[5-[6-(ethylcarbamoylamino)-4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-3-pyridinyl]-2-fluorobenzoyl]but-2-enoate |
|---|---|
| PubChem CID | 70944099 |
| Molecular Formula | C27H27F4N5O4S |
| Molecular Weight | 593.60 g/mol |
| Exact Mass | 593.17 |
| IUPAC Name | ethyl (Z)-4-(dimethylamino)-2-[5-[6-(ethylcarbamoylamino)-4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-3-pyridinyl]-2-fluorobenzoyl]but-2-enoate |
| SMILES | CCNC(=O)Nc1cc(-c2nc(C(F)(F)F)cs2)c(-c2ccc(F)c(C(=O)/C(=C/CN(C)C)C(=O)OCC)c2)cn1 |
| InChI | InChI=1S/C27H27F4N5O4S/c1-5-32-26(39)35-22-12-17(24-34-21(14-41-24)27(29,30)31)19(13-33-22)15-7-8-20(28)18(11-15)23(37)16(9-10-36(3)4)25(38)40-6-2/h7-9,11-14H,5-6,10H2,1-4H3,(H2,32,33,35,39)/b16-9- |
| InChIKey | OAENLDOKDUSWBY-SXGWCWSVSA-N |
| XLogP | 5.41 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.60 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|