C12H14N2O5 — CID 70945719
2-amino-4-(1,3-benzodioxole-5-carbonylamino)butanoic acid (PubChem CID 70945719) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is 2-amino-4-(1,3-benzodioxole-5-carbonylamino)butanoic acid.
| Compound Name | 2-amino-4-(1,3-benzodioxole-5-carbonylamino)butanoic acid |
|---|---|
| PubChem CID | 70945719 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-amino-4-(1,3-benzodioxole-5-carbonylamino)butanoic acid |
| SMILES | NC(CCNC(=O)c1ccc2c(c1)OCO2)C(=O)O |
| InChI | InChI=1S/C12H14N2O5/c13-8(12(16)17)3-4-14-11(15)7-1-2-9-10(5-7)19-6-18-9/h1-2,5,8H,3-4,6,13H2,(H,14,15)(H,16,17) |
| InChIKey | DSKLRMISVTWMEI-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |