C12H23N3O3 — CID 70950413
methyl 4-(2-methylbutan-2-ylcarbamoyl)piperazine-1-carboxylate (PubChem CID 70950413) has the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. Its IUPAC name is methyl 4-(2-methylbutan-2-ylcarbamoyl)piperazine-1-carboxylate.
| Compound Name | methyl 4-(2-methylbutan-2-ylcarbamoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 70950413 |
| Molecular Formula | C12H23N3O3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | methyl 4-(2-methylbutan-2-ylcarbamoyl)piperazine-1-carboxylate |
| SMILES | CCC(C)(C)NC(=O)N1CCN(C(=O)OC)CC1 |
| InChI | InChI=1S/C12H23N3O3/c1-5-12(2,3)13-10(16)14-6-8-15(9-7-14)11(17)18-4/h5-9H2,1-4H3,(H,13,16) |
| InChIKey | YDEMNGSXWLKKLD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |