C20H23NO6S — CID 70951698
(6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-(5-methylsulfonyl-2-propan-2-yloxyphenyl)methanone (PubChem CID 70951698) has the molecular formula C20H23NO6S and a molecular weight of 405.47 g/mol. Its IUPAC name is (6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-(5-methylsulfonyl-2-propan-2-yloxyphenyl)methanone.
| Compound Name | (6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-(5-methylsulfonyl-2-propan-2-yloxyphenyl)methanone |
|---|---|
| PubChem CID | 70951698 |
| Molecular Formula | C20H23NO6S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | (6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-(5-methylsulfonyl-2-propan-2-yloxyphenyl)methanone |
| SMILES | CC(C)Oc1ccc(S(C)(=O)=O)cc1C(=O)N1CCc2cc(O)c(O)cc2C1 |
| InChI | InChI=1S/C20H23NO6S/c1-12(2)27-19-5-4-15(28(3,25)26)10-16(19)20(24)21-7-6-13-8-17(22)18(23)9-14(13)11-21/h4-5,8-10,12,22-23H,6-7,11H2,1-3H3 |
| InChIKey | SNRBFRNWEROVNU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|