C23H29NO4S — CID 59030460
(4-benzylpiperidin-1-yl)-(5-methylsulfonyl-2-propan-2-yloxyphenyl)methanone (PubChem CID 59030460) has the molecular formula C23H29NO4S and a molecular weight of 415.56 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-(5-methylsulfonyl-2-propan-2-yloxyphenyl)methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-(5-methylsulfonyl-2-propan-2-yloxyphenyl)methanone |
|---|---|
| PubChem CID | 59030460 |
| Molecular Formula | C23H29NO4S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-(5-methylsulfonyl-2-propan-2-yloxyphenyl)methanone |
| SMILES | CC(C)Oc1ccc(S(C)(=O)=O)cc1C(=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H29NO4S/c1-17(2)28-22-10-9-20(29(3,26)27)16-21(22)23(25)24-13-11-19(12-14-24)15-18-7-5-4-6-8-18/h4-10,16-17,19H,11-15H2,1-3H3 |
| InChIKey | VUBQINNZNUXUKW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |