C24H28FNO6S — CID 87739797
2-[3-fluoro-4-[1-(5-methylsulfonyl-2-propan-2-yloxybenzoyl)piperidin-4-yl]oxyphenyl]acetaldehyde (PubChem CID 87739797) has the molecular formula C24H28FNO6S and a molecular weight of 477.55 g/mol. Its IUPAC name is 2-[3-fluoro-4-[1-(5-methylsulfonyl-2-propan-2-yloxybenzoyl)piperidin-4-yl]oxyphenyl]acetaldehyde.
| Compound Name | 2-[3-fluoro-4-[1-(5-methylsulfonyl-2-propan-2-yloxybenzoyl)piperidin-4-yl]oxyphenyl]acetaldehyde |
|---|---|
| PubChem CID | 87739797 |
| Molecular Formula | C24H28FNO6S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 2-[3-fluoro-4-[1-(5-methylsulfonyl-2-propan-2-yloxybenzoyl)piperidin-4-yl]oxyphenyl]acetaldehyde |
| SMILES | CC(C)Oc1ccc(S(C)(=O)=O)cc1C(=O)N1CCC(Oc2ccc(CC=O)cc2F)CC1 |
| InChI | InChI=1S/C24H28FNO6S/c1-16(2)31-22-7-5-19(33(3,29)30)15-20(22)24(28)26-11-8-18(9-12-26)32-23-6-4-17(10-13-27)14-21(23)25/h4-7,13-16,18H,8-12H2,1-3H3 |
| InChIKey | WEUMDZJDFIQAEX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|