C23H27FN2O4S2 — CID 87795771
2-[3-fluoro-4-[4-(5-methylsulfonyl-2-propan-2-ylsulfanylbenzoyl)piperazin-1-yl]phenyl]acetaldehyde (PubChem CID 87795771) has the molecular formula C23H27FN2O4S2 and a molecular weight of 478.61 g/mol. Its IUPAC name is 2-[3-fluoro-4-[4-(5-methylsulfonyl-2-propan-2-ylsulfanylbenzoyl)piperazin-1-yl]phenyl]acetaldehyde.
| Compound Name | 2-[3-fluoro-4-[4-(5-methylsulfonyl-2-propan-2-ylsulfanylbenzoyl)piperazin-1-yl]phenyl]acetaldehyde |
|---|---|
| PubChem CID | 87795771 |
| Molecular Formula | C23H27FN2O4S2 |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 2-[3-fluoro-4-[4-(5-methylsulfonyl-2-propan-2-ylsulfanylbenzoyl)piperazin-1-yl]phenyl]acetaldehyde |
| SMILES | CC(C)Sc1ccc(S(C)(=O)=O)cc1C(=O)N1CCN(c2ccc(CC=O)cc2F)CC1 |
| InChI | InChI=1S/C23H27FN2O4S2/c1-16(2)31-22-7-5-18(32(3,29)30)15-19(22)23(28)26-11-9-25(10-12-26)21-6-4-17(8-13-27)14-20(21)24/h4-7,13-16H,8-12H2,1-3H3 |
| InChIKey | NGERYIOKMJGYST-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|